C23H30N3O4S2+ — CID 21295877
2-[4-methoxy-3-methyl-2-(sulfosulfanylmethyl)pyridin-1-ium-1-yl]-5,5,8,8-tetramethyl-6,7-dihydro-1H-benzo[f]benzimidazole (PubChem CID 21295877) has the molecular formula C23H30N3O4S2+ and a molecular weight of 476.64 g/mol. Its IUPAC name is 2-[4-methoxy-3-methyl-2-(sulfosulfanylmethyl)pyridin-1-ium-1-yl]-5,5,8,8-tetramethyl-6,7-dihydro-1H-benzo[f]benzimidazole.
| Compound Name | 2-[4-methoxy-3-methyl-2-(sulfosulfanylmethyl)pyridin-1-ium-1-yl]-5,5,8,8-tetramethyl-6,7-dihydro-1H-benzo[f]benzimidazole |
|---|---|
| PubChem CID | 21295877 |
| Molecular Formula | C23H30N3O4S2+ |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 2-[4-methoxy-3-methyl-2-(sulfosulfanylmethyl)pyridin-1-ium-1-yl]-5,5,8,8-tetramethyl-6,7-dihydro-1H-benzo[f]benzimidazole |
| SMILES | COc1cc[n+](-c2nc3cc4c(cc3[nH]2)C(C)(C)CCC4(C)C)c(CSS(=O)(=O)O)c1C |
| InChI | InChI=1S/C23H29N3O4S2/c1-14-19(13-31-32(27,28)29)26(10-7-20(14)30-6)21-24-17-11-15-16(12-18(17)25-21)23(4,5)9-8-22(15,2)3/h7,10-12H,8-9,13H2,1-6H3,(H-,24,25,27,28,29)/p+1 |
| InChIKey | RUCUAHJPWGXWKC-UHFFFAOYSA-O |
| XLogP | 4.54 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|