C18H22N3O5S2+ — CID 21295998
2-[4-ethoxy-3,5-dimethyl-2-(sulfosulfanylmethyl)pyridin-1-ium-1-yl]-6-methoxy-1H-benzimidazole (PubChem CID 21295998) has the molecular formula C18H22N3O5S2+ and a molecular weight of 424.52 g/mol. Its IUPAC name is 2-[4-ethoxy-3,5-dimethyl-2-(sulfosulfanylmethyl)pyridin-1-ium-1-yl]-6-methoxy-1H-benzimidazole.
| Compound Name | 2-[4-ethoxy-3,5-dimethyl-2-(sulfosulfanylmethyl)pyridin-1-ium-1-yl]-6-methoxy-1H-benzimidazole |
|---|---|
| PubChem CID | 21295998 |
| Molecular Formula | C18H22N3O5S2+ |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 2-[4-ethoxy-3,5-dimethyl-2-(sulfosulfanylmethyl)pyridin-1-ium-1-yl]-6-methoxy-1H-benzimidazole |
| SMILES | CCOc1c(C)c[n+](-c2nc3ccc(OC)cc3[nH]2)c(CSS(=O)(=O)O)c1C |
| InChI | InChI=1S/C18H21N3O5S2/c1-5-26-17-11(2)9-21(16(12(17)3)10-27-28(22,23)24)18-19-14-7-6-13(25-4)8-15(14)20-18/h6-9H,5,10H2,1-4H3,(H-,19,20,22,23,24)/p+1 |
| InChIKey | UTWJBTFWRVGDLN-UHFFFAOYSA-O |
| XLogP | 2.90 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|