C18H22N3O2S2+ — CID 21295997
6-[(ethyldisulfanyl)methyl]-1-(6-methoxy-1H-benzimidazol-2-yl)-3,5-dimethyl-3H-pyridin-1-ium-4-one (PubChem CID 21295997) has the molecular formula C18H22N3O2S2+ and a molecular weight of 376.53 g/mol. Its IUPAC name is 6-[(ethyldisulfanyl)methyl]-1-(6-methoxy-1H-benzimidazol-2-yl)-3,5-dimethyl-3H-pyridin-1-ium-4-one.
| Compound Name | 6-[(ethyldisulfanyl)methyl]-1-(6-methoxy-1H-benzimidazol-2-yl)-3,5-dimethyl-3H-pyridin-1-ium-4-one |
|---|---|
| PubChem CID | 21295997 |
| Molecular Formula | C18H22N3O2S2+ |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 6-[(ethyldisulfanyl)methyl]-1-(6-methoxy-1H-benzimidazol-2-yl)-3,5-dimethyl-3H-pyridin-1-ium-4-one |
| SMILES | CCSSCC1=C(C)C(=O)C(C)C=[N+]1c1nc2ccc(OC)cc2[nH]1 |
| InChI | InChI=1S/C18H22N3O2S2/c1-5-24-25-10-16-12(3)17(22)11(2)9-21(16)18-19-14-7-6-13(23-4)8-15(14)20-18/h6-9,11H,5,10H2,1-4H3,(H,19,20)/q+1 |
| InChIKey | FCTFUCXCPRNHSX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|