C29H31ClFN3O2S2 — CID 88672363
2-[2-[[(4-fluorophenyl)methyldisulfanyl]methyl]-4-methoxy-3-methylpyridin-1-ium-1-yl]-5,5,7,7-tetramethyl-3H-cyclopenta[f]benzimidazol-6-one chloride (PubChem CID 88672363) has the molecular formula C29H31ClFN3O2S2 and a molecular weight of 572.17 g/mol. Its IUPAC name is 2-[2-[[(4-fluorophenyl)methyldisulfanyl]methyl]-4-methoxy-3-methylpyridin-1-ium-1-yl]-5,5,7,7-tetramethyl-3H-cyclopenta[f]benzimidazol-6-one chloride.
| Compound Name | 2-[2-[[(4-fluorophenyl)methyldisulfanyl]methyl]-4-methoxy-3-methylpyridin-1-ium-1-yl]-5,5,7,7-tetramethyl-3H-cyclopenta[f]benzimidazol-6-one chloride |
|---|---|
| PubChem CID | 88672363 |
| Molecular Formula | C29H31ClFN3O2S2 |
| Molecular Weight | 572.17 g/mol |
| Exact Mass | 571.15 |
| IUPAC Name | 2-[2-[[(4-fluorophenyl)methyldisulfanyl]methyl]-4-methoxy-3-methylpyridin-1-ium-1-yl]-5,5,7,7-tetramethyl-3H-cyclopenta[f]benzimidazol-6-one chloride |
| SMILES | COc1cc[n+](-c2nc3cc4c(cc3[nH]2)C(C)(C)C(=O)C4(C)C)c(CSSCc2ccc(F)cc2)c1C.[Cl-] |
| InChI | InChI=1S/C29H31FN3O2S2.ClH/c1-17-24(16-37-36-15-18-7-9-19(30)10-8-18)33(12-11-25(17)35-6)27-31-22-13-20-21(14-23(22)32-27)29(4,5)26(34)28(20,2)3;/h7-14H,15-16H2,1-6H3,(H,31,32);1H/q+1;/p-1 |
| InChIKey | JDKDQWIDWXINBK-UHFFFAOYSA-M |
| XLogP | 3.52 |
| TPSA | 58.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.17 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|