C20H17F3N5OS2+ — CID 21296053
2-[4-methoxy-3-methyl-2-[(pyrimidin-2-yldisulfanyl)methyl]pyridin-1-ium-1-yl]-6-(trifluoromethyl)-1H-benzimidazole (PubChem CID 21296053) has the molecular formula C20H17F3N5OS2+ and a molecular weight of 464.52 g/mol. Its IUPAC name is 2-[4-methoxy-3-methyl-2-[(pyrimidin-2-yldisulfanyl)methyl]pyridin-1-ium-1-yl]-6-(trifluoromethyl)-1H-benzimidazole.
| Compound Name | 2-[4-methoxy-3-methyl-2-[(pyrimidin-2-yldisulfanyl)methyl]pyridin-1-ium-1-yl]-6-(trifluoromethyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 21296053 |
| Molecular Formula | C20H17F3N5OS2+ |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | 2-[4-methoxy-3-methyl-2-[(pyrimidin-2-yldisulfanyl)methyl]pyridin-1-ium-1-yl]-6-(trifluoromethyl)-1H-benzimidazole |
| SMILES | COc1cc[n+](-c2nc3ccc(C(F)(F)F)cc3[nH]2)c(CSSc2ncccn2)c1C |
| InChI | InChI=1S/C20H17F3N5OS2/c1-12-16(11-30-31-19-24-7-3-8-25-19)28(9-6-17(12)29-2)18-26-14-5-4-13(20(21,22)23)10-15(14)27-18/h3-10H,11H2,1-2H3,(H,26,27)/q+1 |
| InChIKey | BHLNDNQQRJAQTR-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|