C19H15ClF3N5S2 — CID 88655393
2-[3-methyl-2-[(pyrimidin-2-yldisulfanyl)methyl]pyridin-1-ium-1-yl]-6-(trifluoromethyl)-1H-benzimidazole chloride (PubChem CID 88655393) has the molecular formula C19H15ClF3N5S2 and a molecular weight of 469.95 g/mol. Its IUPAC name is 2-[3-methyl-2-[(pyrimidin-2-yldisulfanyl)methyl]pyridin-1-ium-1-yl]-6-(trifluoromethyl)-1H-benzimidazole chloride.
| Compound Name | 2-[3-methyl-2-[(pyrimidin-2-yldisulfanyl)methyl]pyridin-1-ium-1-yl]-6-(trifluoromethyl)-1H-benzimidazole chloride |
|---|---|
| PubChem CID | 88655393 |
| Molecular Formula | C19H15ClF3N5S2 |
| Molecular Weight | 469.95 g/mol |
| Exact Mass | 469.04 |
| IUPAC Name | 2-[3-methyl-2-[(pyrimidin-2-yldisulfanyl)methyl]pyridin-1-ium-1-yl]-6-(trifluoromethyl)-1H-benzimidazole chloride |
| SMILES | Cc1ccc[n+](-c2nc3ccc(C(F)(F)F)cc3[nH]2)c1CSSc1ncccn1.[Cl-] |
| InChI | InChI=1S/C19H15F3N5S2.ClH/c1-12-4-2-9-27(16(12)11-28-29-18-23-7-3-8-24-18)17-25-14-6-5-13(19(20,21)22)10-15(14)26-17;/h2-10H,11H2,1H3,(H,25,26);1H/q+1;/p-1 |
| InChIKey | XGVIVBQBONJTSG-UHFFFAOYSA-M |
| XLogP | 1.90 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.95 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|