C13H9F3N2S — CID 81455824
2-(5-methylthiophen-2-yl)-6-(trifluoromethyl)-1H-benzimidazole (PubChem CID 81455824) has the molecular formula C13H9F3N2S and a molecular weight of 282.29 g/mol. Its IUPAC name is 2-(5-methylthiophen-2-yl)-6-(trifluoromethyl)-1H-benzimidazole.
| Compound Name | 2-(5-methylthiophen-2-yl)-6-(trifluoromethyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 81455824 |
| Molecular Formula | C13H9F3N2S |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 2-(5-methylthiophen-2-yl)-6-(trifluoromethyl)-1H-benzimidazole |
| SMILES | Cc1ccc(-c2nc3ccc(C(F)(F)F)cc3[nH]2)s1 |
| InChI | InChI=1S/C13H9F3N2S/c1-7-2-5-11(19-7)12-17-9-4-3-8(13(14,15)16)6-10(9)18-12/h2-6H,1H3,(H,17,18) |
| InChIKey | DZMQUSOHUCKDBW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |