C11H10F3NO4 — CID 123429150
4-(2,2,2-trifluoro-1-hydroxyethoxy)-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol (PubChem CID 123429150) has the molecular formula C11H10F3NO4 and a molecular weight of 277.20 g/mol. Its IUPAC name is 4-(2,2,2-trifluoro-1-hydroxyethoxy)-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol.
| Compound Name | 4-(2,2,2-trifluoro-1-hydroxyethoxy)-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol |
|---|---|
| PubChem CID | 123429150 |
| Molecular Formula | C11H10F3NO4 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 4-(2,2,2-trifluoro-1-hydroxyethoxy)-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol |
| SMILES | Oc1c2c(c(O)n1OC(O)C(F)(F)F)C1C=CC2C1 |
| InChI | InChI=1S/C11H10F3NO4/c12-11(13,14)10(18)19-15-8(16)6-4-1-2-5(3-4)7(6)9(15)17/h1-2,4-5,10,16-18H,3H2 |
| InChIKey | SHCKXMPUAOKQRK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|