C29H9F2NO7S — CID 90985724
octadeca-1,3,5,7,9,11,13,15,17-nonaynyl 2-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxysulfonyl]-2,2-difluoroacetate (PubChem CID 90985724) has the molecular formula C29H9F2NO7S and a molecular weight of 553.45 g/mol. Its IUPAC name is octadeca-1,3,5,7,9,11,13,15,17-nonaynyl 2-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxysulfonyl]-2,2-difluoroacetate.
| Compound Name | octadeca-1,3,5,7,9,11,13,15,17-nonaynyl 2-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxysulfonyl]-2,2-difluoroacetate |
|---|---|
| PubChem CID | 90985724 |
| Molecular Formula | C29H9F2NO7S |
| Molecular Weight | 553.45 g/mol |
| Exact Mass | 553.01 |
| IUPAC Name | octadeca-1,3,5,7,9,11,13,15,17-nonaynyl 2-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxysulfonyl]-2,2-difluoroacetate |
| SMILES | C#CC#CC#CC#CC#CC#CC#CC#CC#COC(=O)C(F)(F)S(=O)(=O)On1c(O)c2c(c1O)C1C=CC2C1 |
| InChI | InChI=1S/C29H9F2NO7S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-38-28(35)29(30,31)40(36,37)39-32-26(33)24-22-18-19-23(21-22)25(24)27(32)34/h1,18-19,22-23,33-34H,21H2 |
| InChIKey | ZQWBVEBWZZEFPE-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.45 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|