C13H19FO — CID 123429547
(4-fluoro-1-propoxyhepta-2,4,6-trien-2-yl)cyclopropane (PubChem CID 123429547) has the molecular formula C13H19FO and a molecular weight of 210.29 g/mol. Its IUPAC name is (4-fluoro-1-propoxyhepta-2,4,6-trien-2-yl)cyclopropane.
| Compound Name | (4-fluoro-1-propoxyhepta-2,4,6-trien-2-yl)cyclopropane |
|---|---|
| PubChem CID | 123429547 |
| Molecular Formula | C13H19FO |
| Molecular Weight | 210.29 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | (4-fluoro-1-propoxyhepta-2,4,6-trien-2-yl)cyclopropane |
| SMILES | C=CC=C(F)C=C(COCCC)C1CC1 |
| InChI | InChI=1S/C13H19FO/c1-3-5-13(14)9-12(11-6-7-11)10-15-8-4-2/h3,5,9,11H,1,4,6-8,10H2,2H3 |
| InChIKey | NQWXGZLGTHLHDS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.29 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|