C14H25FO — CID 123968081
3-(2-ethylidenepent-3-enoxymethyl)-2-fluorohexane (PubChem CID 123968081) has the molecular formula C14H25FO and a molecular weight of 228.35 g/mol. Its IUPAC name is 3-(2-ethylidenepent-3-enoxymethyl)-2-fluorohexane.
| Compound Name | 3-(2-ethylidenepent-3-enoxymethyl)-2-fluorohexane |
|---|---|
| PubChem CID | 123968081 |
| Molecular Formula | C14H25FO |
| Molecular Weight | 228.35 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 3-(2-ethylidenepent-3-enoxymethyl)-2-fluorohexane |
| SMILES | CC=CC(=CC)COCC(CCC)C(C)F |
| InChI | InChI=1S/C14H25FO/c1-5-8-13(7-3)10-16-11-14(9-6-2)12(4)15/h5,7-8,12,14H,6,9-11H2,1-4H3 |
| InChIKey | GCVNUIBZMZQCIC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.35 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|