C13H21FO — CID 154421990
(5S)-5-fluoro-5-(4-methylhexoxy)cyclohexa-1,3-diene (PubChem CID 154421990) has the molecular formula C13H21FO and a molecular weight of 212.31 g/mol. Its IUPAC name is (5S)-5-fluoro-5-(4-methylhexoxy)cyclohexa-1,3-diene.
| Compound Name | (5S)-5-fluoro-5-(4-methylhexoxy)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 154421990 |
| Molecular Formula | C13H21FO |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | (5S)-5-fluoro-5-(4-methylhexoxy)cyclohexa-1,3-diene |
| SMILES | CCC(C)CCCO[C@@]1(F)C=CC=CC1 |
| InChI | InChI=1S/C13H21FO/c1-3-12(2)8-7-11-15-13(14)9-5-4-6-10-13/h4-6,9,12H,3,7-8,10-11H2,1-2H3/t12?,13-/m0/s1 |
| InChIKey | WEYQGYWCGKSZNZ-ABLWVSNPSA-N |
| XLogP | 4.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|