C15H28 — CID 123434058
2-butan-2-yl-5-ethyl-6,7-dimethylspiro[2.4]heptane (PubChem CID 123434058) has the molecular formula C15H28 and a molecular weight of 208.39 g/mol. Its IUPAC name is 2-butan-2-yl-5-ethyl-6,7-dimethylspiro[2.4]heptane.
| Compound Name | 2-butan-2-yl-5-ethyl-6,7-dimethylspiro[2.4]heptane |
|---|---|
| PubChem CID | 123434058 |
| Molecular Formula | C15H28 |
| Molecular Weight | 208.39 g/mol |
| Exact Mass | 208.22 |
| IUPAC Name | 2-butan-2-yl-5-ethyl-6,7-dimethylspiro[2.4]heptane |
| SMILES | CCC(C)C1CC12CC(CC)C(C)C2C |
| InChI | InChI=1S/C15H28/c1-6-10(3)14-9-15(14)8-13(7-2)11(4)12(15)5/h10-14H,6-9H2,1-5H3 |
| InChIKey | KWWBCSYCYOQJRJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.39 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |