C13H24 — CID 123890098
5,6-diethyl-2,7-dimethylspiro[2.4]heptane (PubChem CID 123890098) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is 5,6-diethyl-2,7-dimethylspiro[2.4]heptane.
| Compound Name | 5,6-diethyl-2,7-dimethylspiro[2.4]heptane |
|---|---|
| PubChem CID | 123890098 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | 5,6-diethyl-2,7-dimethylspiro[2.4]heptane |
| SMILES | CCC1CC2(CC2C)C(C)C1CC |
| InChI | InChI=1S/C13H24/c1-5-11-8-13(7-9(13)3)10(4)12(11)6-2/h9-12H,5-8H2,1-4H3 |
| InChIKey | JERSPKAPHHENOB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |