C16H33N — CID 123434402
4-ethenyl-N,8-dimethyl-N-propylnonan-1-amine (PubChem CID 123434402) has the molecular formula C16H33N and a molecular weight of 239.45 g/mol. Its IUPAC name is 4-ethenyl-N,8-dimethyl-N-propylnonan-1-amine.
| Compound Name | 4-ethenyl-N,8-dimethyl-N-propylnonan-1-amine |
|---|---|
| PubChem CID | 123434402 |
| Molecular Formula | C16H33N |
| Molecular Weight | 239.45 g/mol |
| Exact Mass | 239.26 |
| IUPAC Name | 4-ethenyl-N,8-dimethyl-N-propylnonan-1-amine |
| SMILES | C=CC(CCCC(C)C)CCCN(C)CCC |
| InChI | InChI=1S/C16H33N/c1-6-13-17(5)14-9-12-16(7-2)11-8-10-15(3)4/h7,15-16H,2,6,8-14H2,1,3-5H3 |
| InChIKey | TZFXWFOWYWKBAS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|