C20H20F3N3O5 — CID 123434441
3,4-dimethoxy-N-[2-oxo-2-[2-[2,2,2-trifluoro-1-(3-methoxyphenyl)ethylidene]hydrazinyl]ethyl]benzamide (PubChem CID 123434441) has the molecular formula C20H20F3N3O5 and a molecular weight of 439.39 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[2-oxo-2-[2-[2,2,2-trifluoro-1-(3-methoxyphenyl)ethylidene]hydrazinyl]ethyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[2-oxo-2-[2-[2,2,2-trifluoro-1-(3-methoxyphenyl)ethylidene]hydrazinyl]ethyl]benzamide |
|---|---|
| PubChem CID | 123434441 |
| Molecular Formula | C20H20F3N3O5 |
| Molecular Weight | 439.39 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 3,4-dimethoxy-N-[2-oxo-2-[2-[2,2,2-trifluoro-1-(3-methoxyphenyl)ethylidene]hydrazinyl]ethyl]benzamide |
| SMILES | COc1cccc(C(=NNC(=O)CNC(=O)c2ccc(OC)c(OC)c2)C(F)(F)F)c1 |
| InChI | InChI=1S/C20H20F3N3O5/c1-29-14-6-4-5-12(9-14)18(20(21,22)23)26-25-17(27)11-24-19(28)13-7-8-15(30-2)16(10-13)31-3/h4-10H,11H2,1-3H3,(H,24,28)(H,25,27) |
| InChIKey | INSDHYHZEFYUQQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|