C9H10N6S — CID 123434713
2-imino-5-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine-1-carbothioamide (PubChem CID 123434713) has the molecular formula C9H10N6S and a molecular weight of 234.29 g/mol. Its IUPAC name is 2-imino-5-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine-1-carbothioamide.
| Compound Name | 2-imino-5-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine-1-carbothioamide |
|---|---|
| PubChem CID | 123434713 |
| Molecular Formula | C9H10N6S |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 2-imino-5-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine-1-carbothioamide |
| SMILES | [H]/N=c1\ccc(-c2n[nH]c(C)n2)cn1C(N)=S |
| InChI | InChI=1S/C9H10N6S/c1-5-12-8(14-13-5)6-2-3-7(10)15(4-6)9(11)16/h2-4,10H,1H3,(H2,11,16)(H,12,13,14)/b10-7+ |
| InChIKey | LFIQJJQACLIHFT-JXMROGBWSA-N |
| XLogP | 0.15 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|