C17H27F3N2O5 — CID 123435311
2-butoxycarbonyl-2-methyl-4-(2,2,2-trifluoroethyl)-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylic acid (PubChem CID 123435311) has the molecular formula C17H27F3N2O5 and a molecular weight of 396.41 g/mol. Its IUPAC name is 2-butoxycarbonyl-2-methyl-4-(2,2,2-trifluoroethyl)-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylic acid.
| Compound Name | 2-butoxycarbonyl-2-methyl-4-(2,2,2-trifluoroethyl)-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylic acid |
|---|---|
| PubChem CID | 123435311 |
| Molecular Formula | C17H27F3N2O5 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 2-butoxycarbonyl-2-methyl-4-(2,2,2-trifluoroethyl)-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylic acid |
| SMILES | CCCCOC(=O)C1(C)CN(CC(F)(F)F)CC2(CCN(C(=O)O)CC2)O1 |
| InChI | InChI=1S/C17H27F3N2O5/c1-3-4-9-26-13(23)15(2)10-21(12-17(18,19)20)11-16(27-15)5-7-22(8-6-16)14(24)25/h3-12H2,1-2H3,(H,24,25) |
| InChIKey | BZNQXXYSEHXVSD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|