C28H30N2O4S2 — CID 123438424
5,8-bis(5-tert-butyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)quinoxaline (PubChem CID 123438424) has the molecular formula C28H30N2O4S2 and a molecular weight of 522.69 g/mol. Its IUPAC name is 5,8-bis(5-tert-butyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)quinoxaline.
| Compound Name | 5,8-bis(5-tert-butyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)quinoxaline |
|---|---|
| PubChem CID | 123438424 |
| Molecular Formula | C28H30N2O4S2 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | 5,8-bis(5-tert-butyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)quinoxaline |
| SMILES | CC(C)(C)c1sc(-c2ccc(-c3sc(C(C)(C)C)c4c3OCCO4)c3nccnc23)c2c1OCCO2 |
| InChI | InChI=1S/C28H30N2O4S2/c1-27(2,3)25-21-19(31-11-13-33-21)23(35-25)15-7-8-16(18-17(15)29-9-10-30-18)24-20-22(34-14-12-32-20)26(36-24)28(4,5)6/h7-10H,11-14H2,1-6H3 |
| InChIKey | BVZCWHKLMXSKIA-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |