C12H18O5 — CID 123438790
ethyl 2-[(2,2-dimethyl-4,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl)oxy]acetate (PubChem CID 123438790) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is ethyl 2-[(2,2-dimethyl-4,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl)oxy]acetate.
| Compound Name | ethyl 2-[(2,2-dimethyl-4,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl)oxy]acetate |
|---|---|
| PubChem CID | 123438790 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | ethyl 2-[(2,2-dimethyl-4,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl)oxy]acetate |
| SMILES | CCOC(=O)COC1C=CC2OC(C)(C)OC12 |
| InChI | InChI=1S/C12H18O5/c1-4-14-10(13)7-15-8-5-6-9-11(8)17-12(2,3)16-9/h5-6,8-9,11H,4,7H2,1-3H3 |
| InChIKey | UJWBVHVEIICSFT-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|