C20H24NO2+ — CID 123439371
benzyl 2-methyl-3,4,5,6-tetrahydro-1H-2-benzazocin-2-ium-2-carboxylate (PubChem CID 123439371) has the molecular formula C20H24NO2+ and a molecular weight of 310.42 g/mol. Its IUPAC name is benzyl 2-methyl-3,4,5,6-tetrahydro-1H-2-benzazocin-2-ium-2-carboxylate.
| Compound Name | benzyl 2-methyl-3,4,5,6-tetrahydro-1H-2-benzazocin-2-ium-2-carboxylate |
|---|---|
| PubChem CID | 123439371 |
| Molecular Formula | C20H24NO2+ |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | benzyl 2-methyl-3,4,5,6-tetrahydro-1H-2-benzazocin-2-ium-2-carboxylate |
| SMILES | C[N+]1(C(=O)OCc2ccccc2)CCCCc2ccccc2C1 |
| InChI | InChI=1S/C20H24NO2/c1-21(20(22)23-16-17-9-3-2-4-10-17)14-8-7-12-18-11-5-6-13-19(18)15-21/h2-6,9-11,13H,7-8,12,14-16H2,1H3/q+1 |
| InChIKey | UGMPRFATFSIZEL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|