C9H17N3 — CID 123441248
N-[1-(1,4-dihydropyrimidin-2-yl)ethyl]propan-1-amine (PubChem CID 123441248) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is N-[1-(1,4-dihydropyrimidin-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[1-(1,4-dihydropyrimidin-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 123441248 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | N-[1-(1,4-dihydropyrimidin-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(C)C1=NCC=CN1 |
| InChI | InChI=1S/C9H17N3/c1-3-5-10-8(2)9-11-6-4-7-12-9/h4,6,8,10H,3,5,7H2,1-2H3,(H,11,12) |
| InChIKey | XVJFSCQBHUZMRL-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |