C10H19N3 — CID 123954546
N'-[(1Z)-buta-1,3-dienyl]-2-(methylamino)pentanimidamide (PubChem CID 123954546) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is N'-[(1Z)-buta-1,3-dienyl]-2-(methylamino)pentanimidamide.
| Compound Name | N'-[(1Z)-buta-1,3-dienyl]-2-(methylamino)pentanimidamide |
|---|---|
| PubChem CID | 123954546 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | N'-[(1Z)-buta-1,3-dienyl]-2-(methylamino)pentanimidamide |
| SMILES | C=C/C=C\N=C(/N)C(CCC)NC |
| InChI | InChI=1S/C10H19N3/c1-4-6-8-13-10(11)9(12-3)7-5-2/h4,6,8-9,12H,1,5,7H2,2-3H3,(H2,11,13)/b8-6- |
| InChIKey | URCNEFUUUMAUIJ-VURMDHGXSA-N |
| XLogP | 1.43 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|