About 2-(dimethylamino)-N'-[(E)-prop-1-enyl]butanimidamide
2-(dimethylamino)-N'-[(E)-prop-1-enyl]butanimidamide (PubChem CID 141260220) has the molecular formula C9H19N3
and a molecular weight of 169.27 g/mol. Its IUPAC name is 2-(dimethylamino)-N'-[(E)-prop-1-enyl]butanimidamide.
Molecular Properties
| Compound Name | 2-(dimethylamino)-N'-[(E)-prop-1-enyl]butanimidamide |
| PubChem CID | 141260220 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | 2-(dimethylamino)-N'-[(E)-prop-1-enyl]butanimidamide |
| SMILES | C/C=C/N=C(\N)C(CC)N(C)C |
| InChI | InChI=1S/C9H19N3/c1-5-7-11-9(10)8(6-2)12(3)4/h5,7-8H,6H2,1-4H3,(H2,10,11)/b7-5+ |
| InChIKey | JNRLXOKIVIWNGO-FNORWQNLSA-N |
| XLogP | 1.22 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)-N'-[(E)-prop-1-enyl]butanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)-N'-[(E)-prop-1-enyl]butanimidamide?
The IUPAC name of 2-(dimethylamino)-N'-[(E)-prop-1-enyl]butanimidamide (CID 141260220) is 2-(dimethylamino)-N'-[(E)-prop-1-enyl]butanimidamide.
What is the SMILES notation for 2-(dimethylamino)-N'-[(E)-prop-1-enyl]butanimidamide?
The canonical SMILES for 2-(dimethylamino)-N'-[(E)-prop-1-enyl]butanimidamide is C/C=C/N=C(\N)C(CC)N(C)C.
What is the InChIKey of 2-(dimethylamino)-N'-[(E)-prop-1-enyl]butanimidamide?
The InChIKey is JNRLXOKIVIWNGO-FNORWQNLSA-N. The full InChI is InChI=1S/C9H19N3/c1-5-7-11-9(10)8(6-2)12(3)4/h5,7-8H,6H2,1-4H3,(H2,10,11)/b7-5+.
What are the key properties of 2-(dimethylamino)-N'-[(E)-prop-1-enyl]butanimidamide?
2-(dimethylamino)-N'-[(E)-prop-1-enyl]butanimidamide has a molecular weight of 169.27 g/mol, XLogP of 1.22, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-N'-[(E)-prop-1-enyl]butanimidamide is sourced from PubChem (CID 141260220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).