C8H17N3 — CID 141155166
2-(methylamino)-N'-[(E)-prop-1-enyl]butanimidamide (PubChem CID 141155166) has the molecular formula C8H17N3 and a molecular weight of 155.25 g/mol. Its IUPAC name is 2-(methylamino)-N'-[(E)-prop-1-enyl]butanimidamide.
| Compound Name | 2-(methylamino)-N'-[(E)-prop-1-enyl]butanimidamide |
|---|---|
| PubChem CID | 141155166 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.25 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | 2-(methylamino)-N'-[(E)-prop-1-enyl]butanimidamide |
| SMILES | C/C=C/N=C(\N)C(CC)NC |
| InChI | InChI=1S/C8H17N3/c1-4-6-11-8(9)7(5-2)10-3/h4,6-7,10H,5H2,1-3H3,(H2,9,11)/b6-4+ |
| InChIKey | CIJIOSWTMLFLCF-GQCTYLIASA-N |
| XLogP | 0.88 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|