C9H19N3 — CID 123518067
N-ethenyl-N'-methyl-2-(propylamino)propanimidamide (PubChem CID 123518067) has the molecular formula C9H19N3 and a molecular weight of 169.27 g/mol. Its IUPAC name is N-ethenyl-N'-methyl-2-(propylamino)propanimidamide.
| Compound Name | N-ethenyl-N'-methyl-2-(propylamino)propanimidamide |
|---|---|
| PubChem CID | 123518067 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | N-ethenyl-N'-methyl-2-(propylamino)propanimidamide |
| SMILES | C=CN/C(=N\C)C(C)NCCC |
| InChI | InChI=1S/C9H19N3/c1-5-7-12-8(3)9(10-4)11-6-2/h6,8,12H,2,5,7H2,1,3-4H3,(H,10,11) |
| InChIKey | XYFWHEFMAVLZRX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|