C13H25N3 — CID 123950440
1-butan-2-yl-N'-methyl-N-prop-1-enylpyrrolidine-2-carboximidamide (PubChem CID 123950440) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is 1-butan-2-yl-N'-methyl-N-prop-1-enylpyrrolidine-2-carboximidamide.
| Compound Name | 1-butan-2-yl-N'-methyl-N-prop-1-enylpyrrolidine-2-carboximidamide |
|---|---|
| PubChem CID | 123950440 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | 1-butan-2-yl-N'-methyl-N-prop-1-enylpyrrolidine-2-carboximidamide |
| SMILES | CC=CN/C(=N\C)C1CCCN1C(C)CC |
| InChI | InChI=1S/C13H25N3/c1-5-9-15-13(14-4)12-8-7-10-16(12)11(3)6-2/h5,9,11-12H,6-8,10H2,1-4H3,(H,14,15) |
| InChIKey | YDDMZRUSQMPZLL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|