C10H20N4 — CID 163785999
N,N'-dimethyl-N-[(Z)-2-(methylamino)ethenyl]pyrrolidine-2-carboximidamide (PubChem CID 163785999) has the molecular formula C10H20N4 and a molecular weight of 196.30 g/mol. Its IUPAC name is N,N'-dimethyl-N-[(Z)-2-(methylamino)ethenyl]pyrrolidine-2-carboximidamide.
| Compound Name | N,N'-dimethyl-N-[(Z)-2-(methylamino)ethenyl]pyrrolidine-2-carboximidamide |
|---|---|
| PubChem CID | 163785999 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | N,N'-dimethyl-N-[(Z)-2-(methylamino)ethenyl]pyrrolidine-2-carboximidamide |
| SMILES | C/N=C(/C1CCCN1)N(C)/C=C\NC |
| InChI | InChI=1S/C10H20N4/c1-11-7-8-14(3)10(12-2)9-5-4-6-13-9/h7-9,11,13H,4-6H2,1-3H3/b8-7-,12-10- |
| InChIKey | MSOPKBFJKCCDIM-ZMBXXGKISA-N |
| XLogP | 0.39 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|