About N-(chloromethyl)-N'-methyl-1-[3-(methylamino)prop-1-en-2-yl]pyrrolidine-2-carboximidamide
N-(chloromethyl)-N'-methyl-1-[3-(methylamino)prop-1-en-2-yl]pyrrolidine-2-carboximidamide (PubChem CID 134270645) has the molecular formula C11H21ClN4
and a molecular weight of 244.77 g/mol. Its IUPAC name is N-(chloromethyl)-N'-methyl-1-[3-(methylamino)prop-1-en-2-yl]pyrrolidine-2-carboximidamide.
Molecular Properties
| Compound Name | N-(chloromethyl)-N'-methyl-1-[3-(methylamino)prop-1-en-2-yl]pyrrolidine-2-carboximidamide |
| PubChem CID | 134270645 |
| Molecular Formula | C11H21ClN4 |
| Molecular Weight | 244.77 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | N-(chloromethyl)-N'-methyl-1-[3-(methylamino)prop-1-en-2-yl]pyrrolidine-2-carboximidamide |
| SMILES | C=C(CNC)N1CCCC1/C(=N/C)NCCl |
| InChI | InChI=1S/C11H21ClN4/c1-9(7-13-2)16-6-4-5-10(16)11(14-3)15-8-12/h10,13H,1,4-8H2,2-3H3,(H,14,15) |
| InChIKey | LMPZFNFNZULGIC-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.77 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(chloromethyl)-N'-methyl-1-[3-(methylamino)prop-1-en-2-yl]pyrrolidine-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(chloromethyl)-N'-methyl-1-[3-(methylamino)prop-1-en-2-yl]pyrrolidine-2-carboximidamide?
The IUPAC name of N-(chloromethyl)-N'-methyl-1-[3-(methylamino)prop-1-en-2-yl]pyrrolidine-2-carboximidamide (CID 134270645) is N-(chloromethyl)-N'-methyl-1-[3-(methylamino)prop-1-en-2-yl]pyrrolidine-2-carboximidamide.
What is the SMILES notation for N-(chloromethyl)-N'-methyl-1-[3-(methylamino)prop-1-en-2-yl]pyrrolidine-2-carboximidamide?
The canonical SMILES for N-(chloromethyl)-N'-methyl-1-[3-(methylamino)prop-1-en-2-yl]pyrrolidine-2-carboximidamide is C=C(CNC)N1CCCC1/C(=N/C)NCCl.
What is the InChIKey of N-(chloromethyl)-N'-methyl-1-[3-(methylamino)prop-1-en-2-yl]pyrrolidine-2-carboximidamide?
The InChIKey is LMPZFNFNZULGIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21ClN4/c1-9(7-13-2)16-6-4-5-10(16)11(14-3)15-8-12/h10,13H,1,4-8H2,2-3H3,(H,14,15).
What are the key properties of N-(chloromethyl)-N'-methyl-1-[3-(methylamino)prop-1-en-2-yl]pyrrolidine-2-carboximidamide?
N-(chloromethyl)-N'-methyl-1-[3-(methylamino)prop-1-en-2-yl]pyrrolidine-2-carboximidamide has a molecular weight of 244.77 g/mol, XLogP of 1.00, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(chloromethyl)-N'-methyl-1-[3-(methylamino)prop-1-en-2-yl]pyrrolidine-2-carboximidamide is sourced from PubChem (CID 134270645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).