C8H15N3 — CID 145201844
N-ethenyl-N'-methylpyrrolidine-2-carboximidamide (PubChem CID 145201844) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is N-ethenyl-N'-methylpyrrolidine-2-carboximidamide.
| Compound Name | N-ethenyl-N'-methylpyrrolidine-2-carboximidamide |
|---|---|
| PubChem CID | 145201844 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | N-ethenyl-N'-methylpyrrolidine-2-carboximidamide |
| SMILES | C=CN/C(=N\C)C1CCCN1 |
| InChI | InChI=1S/C8H15N3/c1-3-10-8(9-2)7-5-4-6-11-7/h3,7,11H,1,4-6H2,2H3,(H,9,10) |
| InChIKey | OYSBAJBEEDGNFO-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|