C8H13N3 — CID 163548759
2-[(2R)-pyrrolidin-2-yl]-1,4-dihydropyrimidine (PubChem CID 163548759) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is 2-[(2R)-pyrrolidin-2-yl]-1,4-dihydropyrimidine.
| Compound Name | 2-[(2R)-pyrrolidin-2-yl]-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 163548759 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 2-[(2R)-pyrrolidin-2-yl]-1,4-dihydropyrimidine |
| SMILES | C1=CNC([C@H]2CCCN2)=NC1 |
| InChI | InChI=1S/C8H13N3/c1-3-7(9-4-1)8-10-5-2-6-11-8/h2,5,7,9H,1,3-4,6H2,(H,10,11)/t7-/m1/s1 |
| InChIKey | FHGKVJYIQAXIRR-SSDOTTSWSA-N |
| XLogP | 0.25 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |