About 2-(aminomethyl)-6-(3-hydroxy-2-methylpropoxy)-5-methyloxane-3,4-diol
2-(aminomethyl)-6-(3-hydroxy-2-methylpropoxy)-5-methyloxane-3,4-diol (PubChem CID 123441518) has the molecular formula C11H23NO5
and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-(aminomethyl)-6-(3-hydroxy-2-methylpropoxy)-5-methyloxane-3,4-diol.
Molecular Properties
| Compound Name | 2-(aminomethyl)-6-(3-hydroxy-2-methylpropoxy)-5-methyloxane-3,4-diol |
| PubChem CID | 123441518 |
| Molecular Formula | C11H23NO5 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 2-(aminomethyl)-6-(3-hydroxy-2-methylpropoxy)-5-methyloxane-3,4-diol |
| SMILES | CC(CO)COC1OC(CN)C(O)C(O)C1C |
| InChI | InChI=1S/C11H23NO5/c1-6(4-13)5-16-11-7(2)9(14)10(15)8(3-12)17-11/h6-11,13-15H,3-5,12H2,1-2H3 |
| InChIKey | FPANXUXBPYVCDF-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(aminomethyl)-6-(3-hydroxy-2-methylpropoxy)-5-methyloxane-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-6-(3-hydroxy-2-methylpropoxy)-5-methyloxane-3,4-diol?
The IUPAC name of 2-(aminomethyl)-6-(3-hydroxy-2-methylpropoxy)-5-methyloxane-3,4-diol (CID 123441518) is 2-(aminomethyl)-6-(3-hydroxy-2-methylpropoxy)-5-methyloxane-3,4-diol.
What is the SMILES notation for 2-(aminomethyl)-6-(3-hydroxy-2-methylpropoxy)-5-methyloxane-3,4-diol?
The canonical SMILES for 2-(aminomethyl)-6-(3-hydroxy-2-methylpropoxy)-5-methyloxane-3,4-diol is CC(CO)COC1OC(CN)C(O)C(O)C1C.
What is the InChIKey of 2-(aminomethyl)-6-(3-hydroxy-2-methylpropoxy)-5-methyloxane-3,4-diol?
The InChIKey is FPANXUXBPYVCDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO5/c1-6(4-13)5-16-11-7(2)9(14)10(15)8(3-12)17-11/h6-11,13-15H,3-5,12H2,1-2H3.
What are the key properties of 2-(aminomethyl)-6-(3-hydroxy-2-methylpropoxy)-5-methyloxane-3,4-diol?
2-(aminomethyl)-6-(3-hydroxy-2-methylpropoxy)-5-methyloxane-3,4-diol has a molecular weight of 249.31 g/mol, XLogP of -1.33, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-6-(3-hydroxy-2-methylpropoxy)-5-methyloxane-3,4-diol is sourced from PubChem (CID 123441518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).