C12H25NO5 — CID 164965036
2-(hydroxymethyl)-5-methyl-6-[2-(propan-2-ylamino)ethoxy]oxane-3,4-diol (PubChem CID 164965036) has the molecular formula C12H25NO5 and a molecular weight of 263.33 g/mol. Its IUPAC name is 2-(hydroxymethyl)-5-methyl-6-[2-(propan-2-ylamino)ethoxy]oxane-3,4-diol.
| Compound Name | 2-(hydroxymethyl)-5-methyl-6-[2-(propan-2-ylamino)ethoxy]oxane-3,4-diol |
|---|---|
| PubChem CID | 164965036 |
| Molecular Formula | C12H25NO5 |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 2-(hydroxymethyl)-5-methyl-6-[2-(propan-2-ylamino)ethoxy]oxane-3,4-diol |
| SMILES | CC(C)NCCOC1OC(CO)C(O)C(O)C1C |
| InChI | InChI=1S/C12H25NO5/c1-7(2)13-4-5-17-12-8(3)10(15)11(16)9(6-14)18-12/h7-16H,4-6H2,1-3H3 |
| InChIKey | MJIQBQBLHISKFT-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|