C14H24 — CID 123441755
1-ethyl-2-(7-methylocta-5,6-dien-2-yl)cyclopropane (PubChem CID 123441755) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is 1-ethyl-2-(7-methylocta-5,6-dien-2-yl)cyclopropane.
| Compound Name | 1-ethyl-2-(7-methylocta-5,6-dien-2-yl)cyclopropane |
|---|---|
| PubChem CID | 123441755 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | 1-ethyl-2-(7-methylocta-5,6-dien-2-yl)cyclopropane |
| SMILES | CCC1CC1C(C)CCC=C=C(C)C |
| InChI | InChI=1S/C14H24/c1-5-13-10-14(13)12(4)9-7-6-8-11(2)3/h6,12-14H,5,7,9-10H2,1-4H3 |
| InChIKey | BPWBQROGRHRDCJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |