C51H46F4N4O3 — CID 123441805
[[[5-(4,5-diphenyl-1H-imidazol-2-yl)-11-(2-ethylhexyl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] acetate (PubChem CID 123441805) has the molecular formula C51H46F4N4O3 and a molecular weight of 838.95 g/mol. Its IUPAC name is [[[5-(4,5-diphenyl-1H-imidazol-2-yl)-11-(2-ethylhexyl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] acetate.
| Compound Name | [[[5-(4,5-diphenyl-1H-imidazol-2-yl)-11-(2-ethylhexyl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] acetate |
|---|---|
| PubChem CID | 123441805 |
| Molecular Formula | C51H46F4N4O3 |
| Molecular Weight | 838.95 g/mol |
| Exact Mass | 838.35 |
| IUPAC Name | [[[5-(4,5-diphenyl-1H-imidazol-2-yl)-11-(2-ethylhexyl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] acetate |
| SMILES | CCCCC(CC)Cn1c2ccc(C(=NOC(C)=O)c3ccccc3OCC(F)(F)C(F)F)cc2c2cc(-c3nc(-c4ccccc4)c(-c4ccccc4)[nH]3)c3ccccc3c21 |
| InChI | InChI=1S/C51H46F4N4O3/c1-4-6-17-33(5-2)30-59-43-27-26-36(45(58-62-32(3)60)39-24-15-16-25-44(39)61-31-51(54,55)50(52)53)28-40(43)41-29-42(37-22-13-14-23-38(37)48(41)59)49-56-46(34-18-9-7-10-19-34)47(57-49)35-20-11-8-12-21-35/h7-16,18-29,33,50H,4-6,17,30-31H2,1-3H3,(H,56,57) |
| InChIKey | IYERVIHFXSHGDH-UHFFFAOYSA-N |
| XLogP | 13.48 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.95 |
| LogP ≤ 5 | 13.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|