C18H30O4 — CID 123444161
(3,5-dimethyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl) 2-methyl-2-propan-2-ylpentanoate (PubChem CID 123444161) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is (3,5-dimethyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl) 2-methyl-2-propan-2-ylpentanoate.
| Compound Name | (3,5-dimethyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl) 2-methyl-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 123444161 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | (3,5-dimethyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl) 2-methyl-2-propan-2-ylpentanoate |
| SMILES | CCCC(C)(C(=O)OC1C(C)CC2C(C)C(=O)OC21)C(C)C |
| InChI | InChI=1S/C18H30O4/c1-7-8-18(6,10(2)3)17(20)22-14-11(4)9-13-12(5)16(19)21-15(13)14/h10-15H,7-9H2,1-6H3 |
| InChIKey | FBHJQJZZPPLTEL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |