C22H35F3O4 — CID 91264292
[4-methyl-2-oxo-5-(3,3,3-trifluoropropyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl] 2-tert-butyl-2,4-dimethylpentanoate (PubChem CID 91264292) has the molecular formula C22H35F3O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is [4-methyl-2-oxo-5-(3,3,3-trifluoropropyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl] 2-tert-butyl-2,4-dimethylpentanoate.
| Compound Name | [4-methyl-2-oxo-5-(3,3,3-trifluoropropyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl] 2-tert-butyl-2,4-dimethylpentanoate |
|---|---|
| PubChem CID | 91264292 |
| Molecular Formula | C22H35F3O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | [4-methyl-2-oxo-5-(3,3,3-trifluoropropyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl] 2-tert-butyl-2,4-dimethylpentanoate |
| SMILES | CC(C)CC(C)(C(=O)OC1C(CCC(F)(F)F)C(C)C2CC(=O)OC21)C(C)(C)C |
| InChI | InChI=1S/C22H35F3O4/c1-12(2)11-21(7,20(4,5)6)19(27)29-17-14(8-9-22(23,24)25)13(3)15-10-16(26)28-18(15)17/h12-15,17-18H,8-11H2,1-7H3 |
| InChIKey | GOJBNLXIFREVJU-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |