C25H36F6O6 — CID 91539731
1,1,1,3,3,3-hexafluoropropan-2-yl 5-methyl-3-oxo-1-[1-(2,4,4-trimethyl-2-propan-2-ylpentanoyl)oxyethyl]-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3a-carboxylate (PubChem CID 91539731) has the molecular formula C25H36F6O6 and a molecular weight of 546.55 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 5-methyl-3-oxo-1-[1-(2,4,4-trimethyl-2-propan-2-ylpentanoyl)oxyethyl]-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3a-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 5-methyl-3-oxo-1-[1-(2,4,4-trimethyl-2-propan-2-ylpentanoyl)oxyethyl]-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3a-carboxylate |
|---|---|
| PubChem CID | 91539731 |
| Molecular Formula | C25H36F6O6 |
| Molecular Weight | 546.55 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 5-methyl-3-oxo-1-[1-(2,4,4-trimethyl-2-propan-2-ylpentanoyl)oxyethyl]-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3a-carboxylate |
| SMILES | CC1CC2C(C(C)OC(=O)C(C)(CC(C)(C)C)C(C)C)OC(=O)C2(C(=O)OC(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C25H36F6O6/c1-12(2)22(8,11-21(5,6)7)18(32)35-14(4)16-15-9-13(3)10-23(15,19(33)36-16)20(34)37-17(24(26,27)28)25(29,30)31/h12-17H,9-11H2,1-8H3 |
| InChIKey | FNMQSBUFGNCGTD-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.55 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|