C24H34F6O6 — CID 145055455
1,1,1,3,3,3-hexafluoropropan-2-yl 1-[1-(2,4-dimethyl-2-propan-2-ylpentanoyl)oxyethyl]-5-methyl-3-oxo-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3a-carboxylate (PubChem CID 145055455) has the molecular formula C24H34F6O6 and a molecular weight of 532.52 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 1-[1-(2,4-dimethyl-2-propan-2-ylpentanoyl)oxyethyl]-5-methyl-3-oxo-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3a-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 1-[1-(2,4-dimethyl-2-propan-2-ylpentanoyl)oxyethyl]-5-methyl-3-oxo-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3a-carboxylate |
|---|---|
| PubChem CID | 145055455 |
| Molecular Formula | C24H34F6O6 |
| Molecular Weight | 532.52 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 1-[1-(2,4-dimethyl-2-propan-2-ylpentanoyl)oxyethyl]-5-methyl-3-oxo-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3a-carboxylate |
| SMILES | CC(C)CC(C)(C(=O)OC(C)C1OC(=O)C2(C(=O)OC(C(F)(F)F)C(F)(F)F)CC(C)CC12)C(C)C |
| InChI | InChI=1S/C24H34F6O6/c1-11(2)9-21(7,12(3)4)18(31)34-14(6)16-15-8-13(5)10-22(15,19(32)35-16)20(33)36-17(23(25,26)27)24(28,29)30/h11-17H,8-10H2,1-7H3 |
| InChIKey | XGNUSJGLJDWYJP-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.52 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|