C22H33F3O6 — CID 123427697
[3-methyl-2-oxo-5-[2-oxo-2-(2,2,2-trifluoroethoxy)ethyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl] 2,4-dimethyl-2-propan-2-ylpentanoate (PubChem CID 123427697) has the molecular formula C22H33F3O6 and a molecular weight of 450.49 g/mol. Its IUPAC name is [3-methyl-2-oxo-5-[2-oxo-2-(2,2,2-trifluoroethoxy)ethyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl] 2,4-dimethyl-2-propan-2-ylpentanoate.
| Compound Name | [3-methyl-2-oxo-5-[2-oxo-2-(2,2,2-trifluoroethoxy)ethyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl] 2,4-dimethyl-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 123427697 |
| Molecular Formula | C22H33F3O6 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | [3-methyl-2-oxo-5-[2-oxo-2-(2,2,2-trifluoroethoxy)ethyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl] 2,4-dimethyl-2-propan-2-ylpentanoate |
| SMILES | CC(C)CC(C)(C(=O)OC1C(CC(=O)OCC(F)(F)F)CC2C(C)C(=O)OC21)C(C)C |
| InChI | InChI=1S/C22H33F3O6/c1-11(2)9-21(6,12(3)4)20(28)31-17-14(8-16(26)29-10-22(23,24)25)7-15-13(5)19(27)30-18(15)17/h11-15,17-18H,7-10H2,1-6H3 |
| InChIKey | FBYAOYBHPHZDSN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|