C28H46O6 — CID 123206231
[5-[3-(3-cyclopentylpentan-3-yloxy)-3-oxopropyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl] 2-ethyl-2,3-dimethylbutanoate (PubChem CID 123206231) has the molecular formula C28H46O6 and a molecular weight of 478.67 g/mol. Its IUPAC name is [5-[3-(3-cyclopentylpentan-3-yloxy)-3-oxopropyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl] 2-ethyl-2,3-dimethylbutanoate.
| Compound Name | [5-[3-(3-cyclopentylpentan-3-yloxy)-3-oxopropyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl] 2-ethyl-2,3-dimethylbutanoate |
|---|---|
| PubChem CID | 123206231 |
| Molecular Formula | C28H46O6 |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | [5-[3-(3-cyclopentylpentan-3-yloxy)-3-oxopropyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl] 2-ethyl-2,3-dimethylbutanoate |
| SMILES | CCC(CC)(OC(=O)CCC1CC2CC(=O)OC2C1OC(=O)C(C)(CC)C(C)C)C1CCCC1 |
| InChI | InChI=1S/C28H46O6/c1-7-27(6,18(4)5)26(31)33-24-19(16-20-17-23(30)32-25(20)24)14-15-22(29)34-28(8-2,9-3)21-12-10-11-13-21/h18-21,24-25H,7-17H2,1-6H3 |
| InChIKey | BQUWHIPDIRHQES-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|