C22H32F2O11S — CID 154992487
2-[4-[5-(3-cyclopentylpentan-3-yloxycarbonyl)-2-oxooxolan-3-yl]oxy-4-oxobutanoyl]oxy-1,1-difluoropropane-1-sulfonic acid (PubChem CID 154992487) has the molecular formula C22H32F2O11S and a molecular weight of 542.55 g/mol. Its IUPAC name is 2-[4-[5-(3-cyclopentylpentan-3-yloxycarbonyl)-2-oxooxolan-3-yl]oxy-4-oxobutanoyl]oxy-1,1-difluoropropane-1-sulfonic acid.
| Compound Name | 2-[4-[5-(3-cyclopentylpentan-3-yloxycarbonyl)-2-oxooxolan-3-yl]oxy-4-oxobutanoyl]oxy-1,1-difluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 154992487 |
| Molecular Formula | C22H32F2O11S |
| Molecular Weight | 542.55 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | 2-[4-[5-(3-cyclopentylpentan-3-yloxycarbonyl)-2-oxooxolan-3-yl]oxy-4-oxobutanoyl]oxy-1,1-difluoropropane-1-sulfonic acid |
| SMILES | CCC(CC)(OC(=O)C1CC(OC(=O)CCC(=O)OC(C)C(F)(F)S(=O)(=O)O)C(=O)O1)C1CCCC1 |
| InChI | InChI=1S/C22H32F2O11S/c1-4-21(5-2,14-8-6-7-9-14)35-20(28)16-12-15(19(27)34-16)33-18(26)11-10-17(25)32-13(3)22(23,24)36(29,30)31/h13-16H,4-12H2,1-3H3,(H,29,30,31) |
| InChIKey | DBMYQEPKLAYGFQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 159.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.55 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|