C20H36O4S2 — CID 59440731
3-[4-[3-(2-sulfanylacetyl)oxypentan-3-yl]cyclohexyl]pentan-3-yl 2-sulfanylacetate (PubChem CID 59440731) has the molecular formula C20H36O4S2 and a molecular weight of 404.64 g/mol. Its IUPAC name is 3-[4-[3-(2-sulfanylacetyl)oxypentan-3-yl]cyclohexyl]pentan-3-yl 2-sulfanylacetate.
| Compound Name | 3-[4-[3-(2-sulfanylacetyl)oxypentan-3-yl]cyclohexyl]pentan-3-yl 2-sulfanylacetate |
|---|---|
| PubChem CID | 59440731 |
| Molecular Formula | C20H36O4S2 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 3-[4-[3-(2-sulfanylacetyl)oxypentan-3-yl]cyclohexyl]pentan-3-yl 2-sulfanylacetate |
| SMILES | CCC(CC)(OC(=O)CS)C1CCC(C(CC)(CC)OC(=O)CS)CC1 |
| InChI | InChI=1S/C20H36O4S2/c1-5-19(6-2,23-17(21)13-25)15-9-11-16(12-10-15)20(7-3,8-4)24-18(22)14-26/h15-16,25-26H,5-14H2,1-4H3 |
| InChIKey | DJOVIPDNXKHBBQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|