About 3-[4-[3-(2-sulfanylacetyl)oxypentan-3-yl]cyclohexyl]pentan-3-yl 2-sulfanylacetate
3-[4-[3-(2-sulfanylacetyl)oxypentan-3-yl]cyclohexyl]pentan-3-yl 2-sulfanylacetate (PubChem CID 59440731) has the molecular formula C20H36O4S2
and a molecular weight of 404.64 g/mol. Its IUPAC name is 3-[4-[3-(2-sulfanylacetyl)oxypentan-3-yl]cyclohexyl]pentan-3-yl 2-sulfanylacetate.
Molecular Properties
| Compound Name | 3-[4-[3-(2-sulfanylacetyl)oxypentan-3-yl]cyclohexyl]pentan-3-yl 2-sulfanylacetate |
| PubChem CID | 59440731 |
| Molecular Formula | C20H36O4S2 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 3-[4-[3-(2-sulfanylacetyl)oxypentan-3-yl]cyclohexyl]pentan-3-yl 2-sulfanylacetate |
| SMILES | CCC(CC)(OC(=O)CS)C1CCC(C(CC)(CC)OC(=O)CS)CC1 |
| InChI | InChI=1S/C20H36O4S2/c1-5-19(6-2,23-17(21)13-25)15-9-11-16(12-10-15)20(7-3,8-4)24-18(22)14-26/h15-16,25-26H,5-14H2,1-4H3 |
| InChIKey | DJOVIPDNXKHBBQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-[3-(2-sulfanylacetyl)oxypentan-3-yl]cyclohexyl]pentan-3-yl 2-sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[3-(2-sulfanylacetyl)oxypentan-3-yl]cyclohexyl]pentan-3-yl 2-sulfanylacetate?
The IUPAC name of 3-[4-[3-(2-sulfanylacetyl)oxypentan-3-yl]cyclohexyl]pentan-3-yl 2-sulfanylacetate (CID 59440731) is 3-[4-[3-(2-sulfanylacetyl)oxypentan-3-yl]cyclohexyl]pentan-3-yl 2-sulfanylacetate.
What is the SMILES notation for 3-[4-[3-(2-sulfanylacetyl)oxypentan-3-yl]cyclohexyl]pentan-3-yl 2-sulfanylacetate?
The canonical SMILES for 3-[4-[3-(2-sulfanylacetyl)oxypentan-3-yl]cyclohexyl]pentan-3-yl 2-sulfanylacetate is CCC(CC)(OC(=O)CS)C1CCC(C(CC)(CC)OC(=O)CS)CC1.
What is the InChIKey of 3-[4-[3-(2-sulfanylacetyl)oxypentan-3-yl]cyclohexyl]pentan-3-yl 2-sulfanylacetate?
The InChIKey is DJOVIPDNXKHBBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H36O4S2/c1-5-19(6-2,23-17(21)13-25)15-9-11-16(12-10-15)20(7-3,8-4)24-18(22)14-26/h15-16,25-26H,5-14H2,1-4H3.
What are the key properties of 3-[4-[3-(2-sulfanylacetyl)oxypentan-3-yl]cyclohexyl]pentan-3-yl 2-sulfanylacetate?
3-[4-[3-(2-sulfanylacetyl)oxypentan-3-yl]cyclohexyl]pentan-3-yl 2-sulfanylacetate has a molecular weight of 404.64 g/mol, XLogP of 4.86, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[3-(2-sulfanylacetyl)oxypentan-3-yl]cyclohexyl]pentan-3-yl 2-sulfanylacetate is sourced from PubChem (CID 59440731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).