C16H28O4S2 — CID 58944345
2-[4-[2-(2-sulfanylacetyl)oxypropan-2-yl]cyclohexyl]propan-2-yl 2-sulfanylacetate (PubChem CID 58944345) has the molecular formula C16H28O4S2 and a molecular weight of 348.53 g/mol. Its IUPAC name is 2-[4-[2-(2-sulfanylacetyl)oxypropan-2-yl]cyclohexyl]propan-2-yl 2-sulfanylacetate.
| Compound Name | 2-[4-[2-(2-sulfanylacetyl)oxypropan-2-yl]cyclohexyl]propan-2-yl 2-sulfanylacetate |
|---|---|
| PubChem CID | 58944345 |
| Molecular Formula | C16H28O4S2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2-[4-[2-(2-sulfanylacetyl)oxypropan-2-yl]cyclohexyl]propan-2-yl 2-sulfanylacetate |
| SMILES | CC(C)(OC(=O)CS)C1CCC(C(C)(C)OC(=O)CS)CC1 |
| InChI | InChI=1S/C16H28O4S2/c1-15(2,19-13(17)9-21)11-5-7-12(8-6-11)16(3,4)20-14(18)10-22/h11-12,21-22H,5-10H2,1-4H3 |
| InChIKey | MOJCKEWOECEGAF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|