C25H38O6 — CID 129085466
3-cyclopentylpentan-3-yl 2-(2,2-dimethylbutanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate (PubChem CID 129085466) has the molecular formula C25H38O6 and a molecular weight of 434.57 g/mol. Its IUPAC name is 3-cyclopentylpentan-3-yl 2-(2,2-dimethylbutanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate.
| Compound Name | 3-cyclopentylpentan-3-yl 2-(2,2-dimethylbutanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate |
|---|---|
| PubChem CID | 129085466 |
| Molecular Formula | C25H38O6 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | 3-cyclopentylpentan-3-yl 2-(2,2-dimethylbutanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate |
| SMILES | CCC(C)(C)C(=O)OC1C2CC3C1OC(=O)C3(C(=O)OC(CC)(CC)C1CCCC1)C2 |
| InChI | InChI=1S/C25H38O6/c1-6-23(4,5)20(26)29-18-15-13-17-19(18)30-21(27)25(17,14-15)22(28)31-24(7-2,8-3)16-11-9-10-12-16/h15-19H,6-14H2,1-5H3 |
| InChIKey | BSNQIJJXKOVBJN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|