C15H16F3IO6 — CID 155096205
2,2,2-trifluoroethyl 2-(2-iodobutanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate (PubChem CID 155096205) has the molecular formula C15H16F3IO6 and a molecular weight of 476.19 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-(2-iodobutanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl 2-(2-iodobutanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate |
|---|---|
| PubChem CID | 155096205 |
| Molecular Formula | C15H16F3IO6 |
| Molecular Weight | 476.19 g/mol |
| Exact Mass | 475.99 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-(2-iodobutanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate |
| SMILES | CCC(I)C(=O)OC1C2CC3C1OC(=O)C3(C(=O)OCC(F)(F)F)C2 |
| InChI | InChI=1S/C15H16F3IO6/c1-2-8(19)11(20)24-9-6-3-7-10(9)25-13(22)14(7,4-6)12(21)23-5-15(16,17)18/h6-10H,2-5H2,1H3 |
| InChIKey | OCXDUEXZIBXYER-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.19 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|