C22H26O10S — CID 118154978
2-[5-oxo-2-(4-oxoadamantane-1-carbonyl)oxy-4-oxatricyclo[4.2.1.03,7]nonane-6-carbonyl]oxyethanesulfonic acid (PubChem CID 118154978) has the molecular formula C22H26O10S and a molecular weight of 482.51 g/mol. Its IUPAC name is 2-[5-oxo-2-(4-oxoadamantane-1-carbonyl)oxy-4-oxatricyclo[4.2.1.03,7]nonane-6-carbonyl]oxyethanesulfonic acid.
| Compound Name | 2-[5-oxo-2-(4-oxoadamantane-1-carbonyl)oxy-4-oxatricyclo[4.2.1.03,7]nonane-6-carbonyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 118154978 |
| Molecular Formula | C22H26O10S |
| Molecular Weight | 482.51 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | 2-[5-oxo-2-(4-oxoadamantane-1-carbonyl)oxy-4-oxatricyclo[4.2.1.03,7]nonane-6-carbonyl]oxyethanesulfonic acid |
| SMILES | O=C1C2CC3CC1CC(C(=O)OC1C4CC5C1OC(=O)C5(C(=O)OCCS(=O)(=O)O)C4)(C3)C2 |
| InChI | InChI=1S/C22H26O10S/c23-15-11-3-10-4-12(15)8-21(6-10,7-11)18(24)31-16-13-5-14-17(16)32-20(26)22(14,9-13)19(25)30-1-2-33(27,28)29/h10-14,16-17H,1-9H2,(H,27,28,29) |
| InChIKey | PWDXWMVJHKKGIK-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 150.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.51 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|