C24H34O7 — CID 118067372
(1-cyclohexyloxy-2,2-dimethylpropyl) 2-(2-methylprop-2-enoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate (PubChem CID 118067372) has the molecular formula C24H34O7 and a molecular weight of 434.53 g/mol. Its IUPAC name is (1-cyclohexyloxy-2,2-dimethylpropyl) 2-(2-methylprop-2-enoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate.
| Compound Name | (1-cyclohexyloxy-2,2-dimethylpropyl) 2-(2-methylprop-2-enoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate |
|---|---|
| PubChem CID | 118067372 |
| Molecular Formula | C24H34O7 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | (1-cyclohexyloxy-2,2-dimethylpropyl) 2-(2-methylprop-2-enoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate |
| SMILES | C=C(C)C(=O)OC1C2CC3C1OC(=O)C3(C(=O)OC(OC1CCCCC1)C(C)(C)C)C2 |
| InChI | InChI=1S/C24H34O7/c1-13(2)19(25)29-17-14-11-16-18(17)30-20(26)24(16,12-14)21(27)31-22(23(3,4)5)28-15-9-7-6-8-10-15/h14-18,22H,1,6-12H2,2-5H3 |
| InChIKey | ICCPWTFYKJFIRS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|