C22H35NO4 — CID 123283060
[5-(2-cyanoethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl] 2,4,4-trimethyl-2-propan-2-ylhexanoate (PubChem CID 123283060) has the molecular formula C22H35NO4 and a molecular weight of 377.53 g/mol. Its IUPAC name is [5-(2-cyanoethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl] 2,4,4-trimethyl-2-propan-2-ylhexanoate.
| Compound Name | [5-(2-cyanoethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl] 2,4,4-trimethyl-2-propan-2-ylhexanoate |
|---|---|
| PubChem CID | 123283060 |
| Molecular Formula | C22H35NO4 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | [5-(2-cyanoethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl] 2,4,4-trimethyl-2-propan-2-ylhexanoate |
| SMILES | CCC(C)(C)CC(C)(C(=O)OC1C(CCC#N)CC2CC(=O)OC21)C(C)C |
| InChI | InChI=1S/C22H35NO4/c1-7-21(4,5)13-22(6,14(2)3)20(25)27-18-15(9-8-10-23)11-16-12-17(24)26-19(16)18/h14-16,18-19H,7-9,11-13H2,1-6H3 |
| InChIKey | UGEKMVCRMHYJGB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |