C16H23NO4 — CID 164889823
methyl 2-[(1'R,2'R,3'aR,6'aR)-1'-cyano-1',2'-dimethylspiro[1,3-dioxolane-2,6'-3,4,5,6a-tetrahydro-2H-pentalene]-3'a-yl]acetate (PubChem CID 164889823) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is methyl 2-[(1'R,2'R,3'aR,6'aR)-1'-cyano-1',2'-dimethylspiro[1,3-dioxolane-2,6'-3,4,5,6a-tetrahydro-2H-pentalene]-3'a-yl]acetate.
| Compound Name | methyl 2-[(1'R,2'R,3'aR,6'aR)-1'-cyano-1',2'-dimethylspiro[1,3-dioxolane-2,6'-3,4,5,6a-tetrahydro-2H-pentalene]-3'a-yl]acetate |
|---|---|
| PubChem CID | 164889823 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | methyl 2-[(1'R,2'R,3'aR,6'aR)-1'-cyano-1',2'-dimethylspiro[1,3-dioxolane-2,6'-3,4,5,6a-tetrahydro-2H-pentalene]-3'a-yl]acetate |
| SMILES | COC(=O)C[C@]12CCC3(OCCO3)[C@H]1[C@](C)(C#N)[C@H](C)C2 |
| InChI | InChI=1S/C16H23NO4/c1-11-8-15(9-12(18)19-3)4-5-16(20-6-7-21-16)13(15)14(11,2)10-17/h11,13H,4-9H2,1-3H3/t11-,13+,14-,15-/m1/s1 |
| InChIKey | VMYGJYVWYCGHRL-FAAHXZRKSA-N |
| XLogP | 2.26 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |